About 1-bromo-4-propoxybenzene
1-bromo-4-propoxybenzene (PubChem CID 2734198) has the molecular formula C9H11BrO
and a molecular weight of 215.09 g/mol. Its IUPAC name is 1-bromo-4-propoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-propoxybenzene |
| PubChem CID | 2734198 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 1-bromo-4-propoxybenzene |
| SMILES | CCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H11BrO/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3 |
| InChIKey | VVPARGBRVKRZJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-propoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-propoxybenzene?
The IUPAC name of 1-bromo-4-propoxybenzene (CID 2734198) is 1-bromo-4-propoxybenzene.
What is the SMILES notation for 1-bromo-4-propoxybenzene?
The canonical SMILES for 1-bromo-4-propoxybenzene is CCCOc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-propoxybenzene?
The InChIKey is VVPARGBRVKRZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3.
What are the key properties of 1-bromo-4-propoxybenzene?
1-bromo-4-propoxybenzene has a molecular weight of 215.09 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-propoxybenzene is sourced from PubChem (CID 2734198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).