(3-acetylphenyl)boronic acid

C8H9BO3 — CID 2734310

IUPAC(3-acetylphenyl)boronic acid
SMILESCC(=O)c1cccc(B(O)O)c1
InChIInChI=1S/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3
InChIKeySJGGDZCTGBKBCK-UHFFFAOYSA-N
MW163.97 g/mol
LogP-0.43
Rot. Bonds2

About (3-acetylphenyl)boronic acid

(3-acetylphenyl)boronic acid (PubChem CID 2734310) has the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. Its IUPAC name is (3-acetylphenyl)boronic acid.

Molecular Properties

Compound Name(3-acetylphenyl)boronic acid
PubChem CID2734310
Molecular FormulaC8H9BO3
Molecular Weight163.97 g/mol
Exact Mass164.06
IUPAC Name(3-acetylphenyl)boronic acid
SMILESCC(=O)c1cccc(B(O)O)c1
InChIInChI=1S/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3
InChIKeySJGGDZCTGBKBCK-UHFFFAOYSA-N
XLogP-0.43
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.97
LogP ≤ 5-0.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-acetylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-acetylphenyl)boronic acid?
The IUPAC name of (3-acetylphenyl)boronic acid (CID 2734310) is (3-acetylphenyl)boronic acid.
What is the SMILES notation for (3-acetylphenyl)boronic acid?
The canonical SMILES for (3-acetylphenyl)boronic acid is CC(=O)c1cccc(B(O)O)c1.
What is the InChIKey of (3-acetylphenyl)boronic acid?
The InChIKey is SJGGDZCTGBKBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3.
What are the key properties of (3-acetylphenyl)boronic acid?
(3-acetylphenyl)boronic acid has a molecular weight of 163.97 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylphenyl)boronic acid is sourced from PubChem (CID 2734310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).