About [4-(aminomethyl)phenyl]boronic acid;hydrochloride
[4-(aminomethyl)phenyl]boronic acid;hydrochloride (PubChem CID 2734311) has the molecular formula C7H11BClNO2
and a molecular weight of 187.44 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]boronic acid;hydrochloride.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl]boronic acid;hydrochloride |
| PubChem CID | 2734311 |
| Molecular Formula | C7H11BClNO2 |
| Molecular Weight | 187.44 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | [4-(aminomethyl)phenyl]boronic acid;hydrochloride |
| SMILES | Cl.NCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C7H10BNO2.ClH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4,10-11H,5,9H2;1H |
| InChIKey | HUZNRXFJHYNUMV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.44 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)phenyl]boronic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl]boronic acid;hydrochloride?
The IUPAC name of [4-(aminomethyl)phenyl]boronic acid;hydrochloride (CID 2734311) is [4-(aminomethyl)phenyl]boronic acid;hydrochloride.
What is the SMILES notation for [4-(aminomethyl)phenyl]boronic acid;hydrochloride?
The canonical SMILES for [4-(aminomethyl)phenyl]boronic acid;hydrochloride is Cl.NCc1ccc(B(O)O)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl]boronic acid;hydrochloride?
The InChIKey is HUZNRXFJHYNUMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BNO2.ClH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4,10-11H,5,9H2;1H.
What are the key properties of [4-(aminomethyl)phenyl]boronic acid;hydrochloride?
[4-(aminomethyl)phenyl]boronic acid;hydrochloride has a molecular weight of 187.44 g/mol, XLogP of -0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl]boronic acid;hydrochloride is sourced from PubChem (CID 2734311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).