(3-bromophenyl)boronic acid

C6H6BBrO2 — CID 2734318

IUPAC(3-bromophenyl)boronic acid
SMILESOB(O)c1cccc(Br)c1
InChIInChI=1S/C6H6BBrO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H
InChIKeyAFSSVCNPDKKSRR-UHFFFAOYSA-N
MW200.83 g/mol
LogP0.13
Rot. Bonds1

About (3-bromophenyl)boronic acid

(3-bromophenyl)boronic acid (PubChem CID 2734318) has the molecular formula C6H6BBrO2 and a molecular weight of 200.83 g/mol. Its IUPAC name is (3-bromophenyl)boronic acid.

Molecular Properties

Compound Name(3-bromophenyl)boronic acid
PubChem CID2734318
Molecular FormulaC6H6BBrO2
Molecular Weight200.83 g/mol
Exact Mass199.96
IUPAC Name(3-bromophenyl)boronic acid
SMILESOB(O)c1cccc(Br)c1
InChIInChI=1S/C6H6BBrO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H
InChIKeyAFSSVCNPDKKSRR-UHFFFAOYSA-N
XLogP0.13
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.83
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-bromophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-bromophenyl)boronic acid?
The IUPAC name of (3-bromophenyl)boronic acid (CID 2734318) is (3-bromophenyl)boronic acid.
What is the SMILES notation for (3-bromophenyl)boronic acid?
The canonical SMILES for (3-bromophenyl)boronic acid is OB(O)c1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)boronic acid?
The InChIKey is AFSSVCNPDKKSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BBrO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H.
What are the key properties of (3-bromophenyl)boronic acid?
(3-bromophenyl)boronic acid has a molecular weight of 200.83 g/mol, XLogP of 0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)boronic acid is sourced from PubChem (CID 2734318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).