(4-hydroxyphenyl)boronic acid

C6H7BO3 — CID 2734360

IUPAC(4-hydroxyphenyl)boronic acid
SMILESOB(O)c1ccc(O)cc1
InChIInChI=1S/C6H7BO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8-10H
InChIKeyCOIQUVGFTILYGA-UHFFFAOYSA-N
MW137.93 g/mol
LogP-0.93
Rot. Bonds1

About (4-hydroxyphenyl)boronic acid

(4-hydroxyphenyl)boronic acid (PubChem CID 2734360) has the molecular formula C6H7BO3 and a molecular weight of 137.93 g/mol. Its IUPAC name is (4-hydroxyphenyl)boronic acid.

Molecular Properties

Compound Name(4-hydroxyphenyl)boronic acid
PubChem CID2734360
Molecular FormulaC6H7BO3
Molecular Weight137.93 g/mol
Exact Mass138.05
IUPAC Name(4-hydroxyphenyl)boronic acid
SMILESOB(O)c1ccc(O)cc1
InChIInChI=1S/C6H7BO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8-10H
InChIKeyCOIQUVGFTILYGA-UHFFFAOYSA-N
XLogP-0.93
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.93
LogP ≤ 5-0.93
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-hydroxyphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-hydroxyphenyl)boronic acid?
The IUPAC name of (4-hydroxyphenyl)boronic acid (CID 2734360) is (4-hydroxyphenyl)boronic acid.
What is the SMILES notation for (4-hydroxyphenyl)boronic acid?
The canonical SMILES for (4-hydroxyphenyl)boronic acid is OB(O)c1ccc(O)cc1.
What is the InChIKey of (4-hydroxyphenyl)boronic acid?
The InChIKey is COIQUVGFTILYGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8-10H.
What are the key properties of (4-hydroxyphenyl)boronic acid?
(4-hydroxyphenyl)boronic acid has a molecular weight of 137.93 g/mol, XLogP of -0.93, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl)boronic acid is sourced from PubChem (CID 2734360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).