About 1H-indol-5-ylboronic acid
1H-indol-5-ylboronic acid (PubChem CID 2734361) has the molecular formula C8H8BNO2
and a molecular weight of 160.97 g/mol. Its IUPAC name is 1H-indol-5-ylboronic acid.
Molecular Properties
| Compound Name | 1H-indol-5-ylboronic acid |
| PubChem CID | 2734361 |
| Molecular Formula | C8H8BNO2 |
| Molecular Weight | 160.97 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 1H-indol-5-ylboronic acid |
| SMILES | OB(O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H8BNO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10-12H |
| InChIKey | VHADYSUJZAPXOW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.97 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-5-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-5-ylboronic acid?
The IUPAC name of 1H-indol-5-ylboronic acid (CID 2734361) is 1H-indol-5-ylboronic acid.
What is the SMILES notation for 1H-indol-5-ylboronic acid?
The canonical SMILES for 1H-indol-5-ylboronic acid is OB(O)c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indol-5-ylboronic acid?
The InChIKey is VHADYSUJZAPXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BNO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10-12H.
What are the key properties of 1H-indol-5-ylboronic acid?
1H-indol-5-ylboronic acid has a molecular weight of 160.97 g/mol, XLogP of -0.15, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-5-ylboronic acid is sourced from PubChem (CID 2734361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).