About naphthalen-2-ylboronic acid
naphthalen-2-ylboronic acid (PubChem CID 2734375) has the molecular formula C10H9BO2
and a molecular weight of 171.99 g/mol. Its IUPAC name is naphthalen-2-ylboronic acid.
Molecular Properties
| Compound Name | naphthalen-2-ylboronic acid |
| PubChem CID | 2734375 |
| Molecular Formula | C10H9BO2 |
| Molecular Weight | 171.99 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | naphthalen-2-ylboronic acid |
| SMILES | OB(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H |
| InChIKey | KPTRDYONBVUWPD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.99 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylboronic acid?
The IUPAC name of naphthalen-2-ylboronic acid (CID 2734375) is naphthalen-2-ylboronic acid.
What is the SMILES notation for naphthalen-2-ylboronic acid?
The canonical SMILES for naphthalen-2-ylboronic acid is OB(O)c1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylboronic acid?
The InChIKey is KPTRDYONBVUWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H.
What are the key properties of naphthalen-2-ylboronic acid?
naphthalen-2-ylboronic acid has a molecular weight of 171.99 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylboronic acid is sourced from PubChem (CID 2734375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).