About (4-phenoxyphenyl)boronic acid
(4-phenoxyphenyl)boronic acid (PubChem CID 2734377) has the molecular formula C12H11BO3
and a molecular weight of 214.03 g/mol. Its IUPAC name is (4-phenoxyphenyl)boronic acid.
Molecular Properties
| Compound Name | (4-phenoxyphenyl)boronic acid |
| PubChem CID | 2734377 |
| Molecular Formula | C12H11BO3 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (4-phenoxyphenyl)boronic acid |
| SMILES | OB(O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
| InChIKey | KFXUHRXGLWUOJT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl)boronic acid?
The IUPAC name of (4-phenoxyphenyl)boronic acid (CID 2734377) is (4-phenoxyphenyl)boronic acid.
What is the SMILES notation for (4-phenoxyphenyl)boronic acid?
The canonical SMILES for (4-phenoxyphenyl)boronic acid is OB(O)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (4-phenoxyphenyl)boronic acid?
The InChIKey is KFXUHRXGLWUOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H.
What are the key properties of (4-phenoxyphenyl)boronic acid?
(4-phenoxyphenyl)boronic acid has a molecular weight of 214.03 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl)boronic acid is sourced from PubChem (CID 2734377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).