(2,4,6-trichlorophenyl)boronic acid

C6H4BCl3O2 — CID 2734384

IUPAC(2,4,6-trichlorophenyl)boronic acid
SMILESOB(O)c1c(Cl)cc(Cl)cc1Cl
InChIInChI=1S/C6H4BCl3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,11-12H
InChIKeyJWWBOINZBOIAHR-UHFFFAOYSA-N
MW225.27 g/mol
LogP1.33
Rot. Bonds1

About (2,4,6-trichlorophenyl)boronic acid

(2,4,6-trichlorophenyl)boronic acid (PubChem CID 2734384) has the molecular formula C6H4BCl3O2 and a molecular weight of 225.27 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl)boronic acid.

Molecular Properties

Compound Name(2,4,6-trichlorophenyl)boronic acid
PubChem CID2734384
Molecular FormulaC6H4BCl3O2
Molecular Weight225.27 g/mol
Exact Mass223.94
IUPAC Name(2,4,6-trichlorophenyl)boronic acid
SMILESOB(O)c1c(Cl)cc(Cl)cc1Cl
InChIInChI=1S/C6H4BCl3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,11-12H
InChIKeyJWWBOINZBOIAHR-UHFFFAOYSA-N
XLogP1.33
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.27
LogP ≤ 51.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,4,6-trichlorophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4,6-trichlorophenyl)boronic acid?
The IUPAC name of (2,4,6-trichlorophenyl)boronic acid (CID 2734384) is (2,4,6-trichlorophenyl)boronic acid.
What is the SMILES notation for (2,4,6-trichlorophenyl)boronic acid?
The canonical SMILES for (2,4,6-trichlorophenyl)boronic acid is OB(O)c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of (2,4,6-trichlorophenyl)boronic acid?
The InChIKey is JWWBOINZBOIAHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BCl3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,11-12H.
What are the key properties of (2,4,6-trichlorophenyl)boronic acid?
(2,4,6-trichlorophenyl)boronic acid has a molecular weight of 225.27 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trichlorophenyl)boronic acid is sourced from PubChem (CID 2734384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).