About 3-bromopyridine-2,5-diamine
3-bromopyridine-2,5-diamine (PubChem CID 2734413) has the molecular formula C5H6BrN3
and a molecular weight of 188.03 g/mol. Its IUPAC name is 3-bromopyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-bromopyridine-2,5-diamine |
| PubChem CID | 2734413 |
| Molecular Formula | C5H6BrN3 |
| Molecular Weight | 188.03 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 3-bromopyridine-2,5-diamine |
| SMILES | Nc1cnc(N)c(Br)c1 |
| InChI | InChI=1S/C5H6BrN3/c6-4-1-3(7)2-9-5(4)8/h1-2H,7H2,(H2,8,9) |
| InChIKey | YJENCMIONVUOCW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.03 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromopyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine-2,5-diamine?
The IUPAC name of 3-bromopyridine-2,5-diamine (CID 2734413) is 3-bromopyridine-2,5-diamine.
What is the SMILES notation for 3-bromopyridine-2,5-diamine?
The canonical SMILES for 3-bromopyridine-2,5-diamine is Nc1cnc(N)c(Br)c1.
What is the InChIKey of 3-bromopyridine-2,5-diamine?
The InChIKey is YJENCMIONVUOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrN3/c6-4-1-3(7)2-9-5(4)8/h1-2H,7H2,(H2,8,9).
What are the key properties of 3-bromopyridine-2,5-diamine?
3-bromopyridine-2,5-diamine has a molecular weight of 188.03 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine-2,5-diamine is sourced from PubChem (CID 2734413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).