About 5-bromo-2-chloropyridine
5-bromo-2-chloropyridine (PubChem CID 2734414) has the molecular formula C5H3BrClN
and a molecular weight of 192.44 g/mol. Its IUPAC name is 5-bromo-2-chloropyridine.
Molecular Properties
| Compound Name | 5-bromo-2-chloropyridine |
| PubChem CID | 2734414 |
| Molecular Formula | C5H3BrClN |
| Molecular Weight | 192.44 g/mol |
| Exact Mass | 190.91 |
| IUPAC Name | 5-bromo-2-chloropyridine |
| SMILES | Clc1ccc(Br)cn1 |
| InChI | InChI=1S/C5H3BrClN/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | PEAOEIWYQVXZMB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloropyridine?
The IUPAC name of 5-bromo-2-chloropyridine (CID 2734414) is 5-bromo-2-chloropyridine.
What is the SMILES notation for 5-bromo-2-chloropyridine?
The canonical SMILES for 5-bromo-2-chloropyridine is Clc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-2-chloropyridine?
The InChIKey is PEAOEIWYQVXZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrClN/c6-4-1-2-5(7)8-3-4/h1-3H.
What are the key properties of 5-bromo-2-chloropyridine?
5-bromo-2-chloropyridine has a molecular weight of 192.44 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloropyridine is sourced from PubChem (CID 2734414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).