About 2-(2,3-dichlorophenyl)acetic acid
2-(2,3-dichlorophenyl)acetic acid (PubChem CID 2734600) has the molecular formula C8H6Cl2O2
and a molecular weight of 205.04 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,3-dichlorophenyl)acetic acid |
| PubChem CID | 2734600 |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 2-(2,3-dichlorophenyl)acetic acid |
| SMILES | O=C(O)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | YWMXEUIQZOQESD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,3-dichlorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichlorophenyl)acetic acid?
The IUPAC name of 2-(2,3-dichlorophenyl)acetic acid (CID 2734600) is 2-(2,3-dichlorophenyl)acetic acid.
What is the SMILES notation for 2-(2,3-dichlorophenyl)acetic acid?
The canonical SMILES for 2-(2,3-dichlorophenyl)acetic acid is O=C(O)Cc1cccc(Cl)c1Cl.
What is the InChIKey of 2-(2,3-dichlorophenyl)acetic acid?
The InChIKey is YWMXEUIQZOQESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12).
What are the key properties of 2-(2,3-dichlorophenyl)acetic acid?
2-(2,3-dichlorophenyl)acetic acid has a molecular weight of 205.04 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenyl)acetic acid is sourced from PubChem (CID 2734600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).