C12H24B2O4 — CID 2734616
4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane (PubChem CID 2734616) has the molecular formula C12H24B2O4 and a molecular weight of 253.94 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane.
| Compound Name | 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 2734616 |
| Molecular Formula | C12H24B2O4 |
| Molecular Weight | 253.94 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane |
| SMILES | CC1CC(C)(C)OB(B2OC(C)CC(C)(C)O2)O1 |
| InChI | InChI=1S/C12H24B2O4/c1-9-7-11(3,4)17-13(15-9)14-16-10(2)8-12(5,6)18-14/h9-10H,7-8H2,1-6H3 |
| InChIKey | UEBSWKNVDRJVHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.94 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|