About 2-piperazin-1-ylpyrazine
2-piperazin-1-ylpyrazine (PubChem CID 2734639) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-piperazin-1-ylpyrazine.
Molecular Properties
| Compound Name | 2-piperazin-1-ylpyrazine |
| PubChem CID | 2734639 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-piperazin-1-ylpyrazine |
| SMILES | c1cnc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C8H12N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7,9H,3-6H2 |
| InChIKey | HCGFLVDMFDHYJD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylpyrazine?
The IUPAC name of 2-piperazin-1-ylpyrazine (CID 2734639) is 2-piperazin-1-ylpyrazine.
What is the SMILES notation for 2-piperazin-1-ylpyrazine?
The canonical SMILES for 2-piperazin-1-ylpyrazine is c1cnc(N2CCNCC2)cn1.
What is the InChIKey of 2-piperazin-1-ylpyrazine?
The InChIKey is HCGFLVDMFDHYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7,9H,3-6H2.
What are the key properties of 2-piperazin-1-ylpyrazine?
2-piperazin-1-ylpyrazine has a molecular weight of 164.21 g/mol, XLogP of -0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylpyrazine is sourced from PubChem (CID 2734639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).