About quinolin-3-ylboronic acid
quinolin-3-ylboronic acid (PubChem CID 2734663) has the molecular formula C9H8BNO2
and a molecular weight of 172.98 g/mol. Its IUPAC name is quinolin-3-ylboronic acid.
Molecular Properties
| Compound Name | quinolin-3-ylboronic acid |
| PubChem CID | 2734663 |
| Molecular Formula | C9H8BNO2 |
| Molecular Weight | 172.98 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | quinolin-3-ylboronic acid |
| SMILES | OB(O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C9H8BNO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6,12-13H |
| InChIKey | YGDICLRMNDWZAK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.98 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze quinolin-3-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-3-ylboronic acid?
The IUPAC name of quinolin-3-ylboronic acid (CID 2734663) is quinolin-3-ylboronic acid.
What is the SMILES notation for quinolin-3-ylboronic acid?
The canonical SMILES for quinolin-3-ylboronic acid is OB(O)c1cnc2ccccc2c1.
What is the InChIKey of quinolin-3-ylboronic acid?
The InChIKey is YGDICLRMNDWZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BNO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6,12-13H.
What are the key properties of quinolin-3-ylboronic acid?
quinolin-3-ylboronic acid has a molecular weight of 172.98 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-3-ylboronic acid is sourced from PubChem (CID 2734663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).