(3,5-dibromophenyl)boronic acid

C6H5BBr2O2 — CID 2734689

IUPAC(3,5-dibromophenyl)boronic acid
SMILESOB(O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H
InChIKeyWQBLCGDZYFKINX-UHFFFAOYSA-N
MW279.72 g/mol
LogP0.89
Rot. Bonds1

About (3,5-dibromophenyl)boronic acid

(3,5-dibromophenyl)boronic acid (PubChem CID 2734689) has the molecular formula C6H5BBr2O2 and a molecular weight of 279.72 g/mol. Its IUPAC name is (3,5-dibromophenyl)boronic acid.

Molecular Properties

Compound Name(3,5-dibromophenyl)boronic acid
PubChem CID2734689
Molecular FormulaC6H5BBr2O2
Molecular Weight279.72 g/mol
Exact Mass277.87
IUPAC Name(3,5-dibromophenyl)boronic acid
SMILESOB(O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H
InChIKeyWQBLCGDZYFKINX-UHFFFAOYSA-N
XLogP0.89
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.72
LogP ≤ 50.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,5-dibromophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dibromophenyl)boronic acid?
The IUPAC name of (3,5-dibromophenyl)boronic acid (CID 2734689) is (3,5-dibromophenyl)boronic acid.
What is the SMILES notation for (3,5-dibromophenyl)boronic acid?
The canonical SMILES for (3,5-dibromophenyl)boronic acid is OB(O)c1cc(Br)cc(Br)c1.
What is the InChIKey of (3,5-dibromophenyl)boronic acid?
The InChIKey is WQBLCGDZYFKINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H.
What are the key properties of (3,5-dibromophenyl)boronic acid?
(3,5-dibromophenyl)boronic acid has a molecular weight of 279.72 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dibromophenyl)boronic acid is sourced from PubChem (CID 2734689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).