About 1,2,3,4-tetrahydroisoquinoline;hydrochloride
1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 2734717) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| PubChem CID | 2734717 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H |
| InChIKey | MGFREDWKELGWML-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3,4-tetrahydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydroisoquinoline;hydrochloride?
The IUPAC name of 1,2,3,4-tetrahydroisoquinoline;hydrochloride (CID 2734717) is 1,2,3,4-tetrahydroisoquinoline;hydrochloride.
What is the SMILES notation for 1,2,3,4-tetrahydroisoquinoline;hydrochloride?
The canonical SMILES for 1,2,3,4-tetrahydroisoquinoline;hydrochloride is Cl.c1ccc2c(c1)CCNC2.
What is the InChIKey of 1,2,3,4-tetrahydroisoquinoline;hydrochloride?
The InChIKey is MGFREDWKELGWML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H.
What are the key properties of 1,2,3,4-tetrahydroisoquinoline;hydrochloride?
1,2,3,4-tetrahydroisoquinoline;hydrochloride has a molecular weight of 169.66 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydroisoquinoline;hydrochloride is sourced from PubChem (CID 2734717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).