About [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate
[(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate (PubChem CID 2734730) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate |
| PubChem CID | 2734730 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1COC=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H12O5/c1-6(10)13-8-3-4-12-5-9(8)14-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | OWKCFBYWQGPLSJ-BDAKNGLRSA-N |
| XLogP | 0.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate?
The IUPAC name of [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate (CID 2734730) is [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate.
What is the SMILES notation for [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate?
The canonical SMILES for [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate is CC(=O)O[C@H]1COC=C[C@H]1OC(C)=O.
What is the InChIKey of [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate?
The InChIKey is OWKCFBYWQGPLSJ-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H12O5/c1-6(10)13-8-3-4-12-5-9(8)14-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+/m1/s1.
What are the key properties of [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate?
[(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate has a molecular weight of 200.19 g/mol, XLogP of 0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-acetyloxy-3,4-dihydro-2H-pyran-3-yl] acetate is sourced from PubChem (CID 2734730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).