C11H14O7 — CID 2734748
methyl (2S,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 2734748) has the molecular formula C11H14O7 and a molecular weight of 258.23 g/mol. Its IUPAC name is methyl (2S,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 2734748 |
| Molecular Formula | C11H14O7 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | methyl (2S,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H14O7/c1-6(12)17-8-4-5-16-10(11(14)15-3)9(8)18-7(2)13/h4-5,8-10H,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | QYYMNOQXLQYOFN-UTLUCORTSA-N |
| XLogP | -0.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|