About 2-hydroxy-1,2-dithiophen-2-ylethanone
2-hydroxy-1,2-dithiophen-2-ylethanone (PubChem CID 2734800) has the molecular formula C10H8O2S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-hydroxy-1,2-dithiophen-2-ylethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1,2-dithiophen-2-ylethanone |
| PubChem CID | 2734800 |
| Molecular Formula | C10H8O2S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2-hydroxy-1,2-dithiophen-2-ylethanone |
| SMILES | O=C(c1cccs1)C(O)c1cccs1 |
| InChI | InChI=1S/C10H8O2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H |
| InChIKey | OGWZIOZTPNLTCR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1,2-dithiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,2-dithiophen-2-ylethanone?
The IUPAC name of 2-hydroxy-1,2-dithiophen-2-ylethanone (CID 2734800) is 2-hydroxy-1,2-dithiophen-2-ylethanone.
What is the SMILES notation for 2-hydroxy-1,2-dithiophen-2-ylethanone?
The canonical SMILES for 2-hydroxy-1,2-dithiophen-2-ylethanone is O=C(c1cccs1)C(O)c1cccs1.
What is the InChIKey of 2-hydroxy-1,2-dithiophen-2-ylethanone?
The InChIKey is OGWZIOZTPNLTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H.
What are the key properties of 2-hydroxy-1,2-dithiophen-2-ylethanone?
2-hydroxy-1,2-dithiophen-2-ylethanone has a molecular weight of 224.31 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,2-dithiophen-2-ylethanone is sourced from PubChem (CID 2734800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).