About (2R,3S)-oxirane-2,3-dicarboxylic acid
(2R,3S)-oxirane-2,3-dicarboxylic acid (PubChem CID 2734802) has the molecular formula C4H4O5
and a molecular weight of 132.07 g/mol. Its IUPAC name is (2R,3S)-oxirane-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R,3S)-oxirane-2,3-dicarboxylic acid |
| PubChem CID | 2734802 |
| Molecular Formula | C4H4O5 |
| Molecular Weight | 132.07 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | (2R,3S)-oxirane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@H]1C(=O)O |
| InChI | InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2+ |
| InChIKey | DCEMCPAKSGRHCN-XIXRPRMCSA-N |
| XLogP | -1.08 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.07 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-oxirane-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-oxirane-2,3-dicarboxylic acid?
The IUPAC name of (2R,3S)-oxirane-2,3-dicarboxylic acid (CID 2734802) is (2R,3S)-oxirane-2,3-dicarboxylic acid.
What is the SMILES notation for (2R,3S)-oxirane-2,3-dicarboxylic acid?
The canonical SMILES for (2R,3S)-oxirane-2,3-dicarboxylic acid is O=C(O)[C@H]1O[C@H]1C(=O)O.
What is the InChIKey of (2R,3S)-oxirane-2,3-dicarboxylic acid?
The InChIKey is DCEMCPAKSGRHCN-XIXRPRMCSA-N. The full InChI is InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2+.
What are the key properties of (2R,3S)-oxirane-2,3-dicarboxylic acid?
(2R,3S)-oxirane-2,3-dicarboxylic acid has a molecular weight of 132.07 g/mol, XLogP of -1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-oxirane-2,3-dicarboxylic acid is sourced from PubChem (CID 2734802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).