About 4-bromobenzenediazonium
4-bromobenzenediazonium (PubChem CID 2734811) has the molecular formula C6H4BrN2+
and a molecular weight of 184.02 g/mol. Its IUPAC name is 4-bromobenzenediazonium.
Molecular Properties
| Compound Name | 4-bromobenzenediazonium |
| PubChem CID | 2734811 |
| Molecular Formula | C6H4BrN2+ |
| Molecular Weight | 184.02 g/mol |
| Exact Mass | 182.96 |
| IUPAC Name | 4-bromobenzenediazonium |
| SMILES | N#[N+]c1ccc(Br)cc1 |
| InChI | InChI=1S/C6H4BrN2/c7-5-1-3-6(9-8)4-2-5/h1-4H/q+1 |
| InChIKey | UPQQTAIBAVTEGV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.02 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzenediazonium?
The IUPAC name of 4-bromobenzenediazonium (CID 2734811) is 4-bromobenzenediazonium.
What is the SMILES notation for 4-bromobenzenediazonium?
The canonical SMILES for 4-bromobenzenediazonium is N#[N+]c1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzenediazonium?
The InChIKey is UPQQTAIBAVTEGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN2/c7-5-1-3-6(9-8)4-2-5/h1-4H/q+1.
What are the key properties of 4-bromobenzenediazonium?
4-bromobenzenediazonium has a molecular weight of 184.02 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzenediazonium is sourced from PubChem (CID 2734811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).