About 2-aminopropane-1,3-diol;hydrochloride
2-aminopropane-1,3-diol;hydrochloride (PubChem CID 2734815) has the molecular formula C3H10ClNO2
and a molecular weight of 127.57 g/mol. Its IUPAC name is 2-aminopropane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-aminopropane-1,3-diol;hydrochloride |
| PubChem CID | 2734815 |
| Molecular Formula | C3H10ClNO2 |
| Molecular Weight | 127.57 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 2-aminopropane-1,3-diol;hydrochloride |
| SMILES | Cl.NC(CO)CO |
| InChI | InChI=1S/C3H9NO2.ClH/c4-3(1-5)2-6;/h3,5-6H,1-2,4H2;1H |
| InChIKey | VDGBLRKKPTUYNW-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.57 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopropane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropane-1,3-diol;hydrochloride?
The IUPAC name of 2-aminopropane-1,3-diol;hydrochloride (CID 2734815) is 2-aminopropane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-aminopropane-1,3-diol;hydrochloride?
The canonical SMILES for 2-aminopropane-1,3-diol;hydrochloride is Cl.NC(CO)CO.
What is the InChIKey of 2-aminopropane-1,3-diol;hydrochloride?
The InChIKey is VDGBLRKKPTUYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2.ClH/c4-3(1-5)2-6;/h3,5-6H,1-2,4H2;1H.
What are the key properties of 2-aminopropane-1,3-diol;hydrochloride?
2-aminopropane-1,3-diol;hydrochloride has a molecular weight of 127.57 g/mol, XLogP of -1.28, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropane-1,3-diol;hydrochloride is sourced from PubChem (CID 2734815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).