C21H27ClN2 — CID 2734917
1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride (PubChem CID 2734917) has the molecular formula C21H27ClN2 and a molecular weight of 342.91 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride |
|---|---|
| PubChem CID | 2734917 |
| Molecular Formula | C21H27ClN2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride |
| SMILES | Cc1cc(C)c(N2C=[N+](c3c(C)cc(C)cc3C)CC2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C21H27N2.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;/h9-13H,7-8H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | COGMCBFILULEOS-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|