About propyl (2S)-2-hydroxypropanoate
propyl (2S)-2-hydroxypropanoate (PubChem CID 2734942) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is propyl (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | propyl (2S)-2-hydroxypropanoate |
| PubChem CID | 2734942 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | propyl (2S)-2-hydroxypropanoate |
| SMILES | CCCOC(=O)[C@H](C)O |
| InChI | InChI=1S/C6H12O3/c1-3-4-9-6(8)5(2)7/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | ILVGAIQLOCKNQA-YFKPBYRVSA-N |
| XLogP | 0.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl (2S)-2-hydroxypropanoate?
The IUPAC name of propyl (2S)-2-hydroxypropanoate (CID 2734942) is propyl (2S)-2-hydroxypropanoate.
What is the SMILES notation for propyl (2S)-2-hydroxypropanoate?
The canonical SMILES for propyl (2S)-2-hydroxypropanoate is CCCOC(=O)[C@H](C)O.
What is the InChIKey of propyl (2S)-2-hydroxypropanoate?
The InChIKey is ILVGAIQLOCKNQA-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12O3/c1-3-4-9-6(8)5(2)7/h5,7H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of propyl (2S)-2-hydroxypropanoate?
propyl (2S)-2-hydroxypropanoate has a molecular weight of 132.16 g/mol, XLogP of 0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl (2S)-2-hydroxypropanoate is sourced from PubChem (CID 2734942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).