About (4R)-4-benzyl-1,3-oxazolidin-2-one
(4R)-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 2734969) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is (4R)-4-benzyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-benzyl-1,3-oxazolidin-2-one |
| PubChem CID | 2734969 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (4R)-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C10H11NO2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)/t9-/m1/s1 |
| InChIKey | OJOFMLDBXPDXLQ-SECBINFHSA-N |
| XLogP | 1.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-benzyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-benzyl-1,3-oxazolidin-2-one?
The IUPAC name of (4R)-4-benzyl-1,3-oxazolidin-2-one (CID 2734969) is (4R)-4-benzyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R)-4-benzyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R)-4-benzyl-1,3-oxazolidin-2-one is O=C1N[C@H](Cc2ccccc2)CO1.
What is the InChIKey of (4R)-4-benzyl-1,3-oxazolidin-2-one?
The InChIKey is OJOFMLDBXPDXLQ-SECBINFHSA-N. The full InChI is InChI=1S/C10H11NO2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)/t9-/m1/s1.
What are the key properties of (4R)-4-benzyl-1,3-oxazolidin-2-one?
(4R)-4-benzyl-1,3-oxazolidin-2-one has a molecular weight of 177.20 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-benzyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 2734969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).