About 1,4-dihydroquinoxaline-2,3-dithione
1,4-dihydroquinoxaline-2,3-dithione (PubChem CID 2735127) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,4-dihydroquinoxaline-2,3-dithione.
Molecular Properties
| Compound Name | 1,4-dihydroquinoxaline-2,3-dithione |
| PubChem CID | 2735127 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1,4-dihydroquinoxaline-2,3-dithione |
| SMILES | S=c1[nH]c2ccccc2[nH]c1=S |
| InChI | InChI=1S/C8H6N2S2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | YFBUDXNMBTUSOC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroquinoxaline-2,3-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroquinoxaline-2,3-dithione?
The IUPAC name of 1,4-dihydroquinoxaline-2,3-dithione (CID 2735127) is 1,4-dihydroquinoxaline-2,3-dithione.
What is the SMILES notation for 1,4-dihydroquinoxaline-2,3-dithione?
The canonical SMILES for 1,4-dihydroquinoxaline-2,3-dithione is S=c1[nH]c2ccccc2[nH]c1=S.
What is the InChIKey of 1,4-dihydroquinoxaline-2,3-dithione?
The InChIKey is YFBUDXNMBTUSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12).
What are the key properties of 1,4-dihydroquinoxaline-2,3-dithione?
1,4-dihydroquinoxaline-2,3-dithione has a molecular weight of 194.28 g/mol, XLogP of 2.95, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroquinoxaline-2,3-dithione is sourced from PubChem (CID 2735127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).