About N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide
N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 27352472) has the molecular formula C17H21NO3S3
and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide |
| PubChem CID | 27352472 |
| Molecular Formula | C17H21NO3S3 |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | Cc1ccc(SCC(=O)c2ccc(CCNS(C)(=O)=O)s2)c(C)c1 |
| InChI | InChI=1S/C17H21NO3S3/c1-12-4-6-16(13(2)10-12)22-11-15(19)17-7-5-14(23-17)8-9-18-24(3,20)21/h4-7,10,18H,8-9,11H2,1-3H3 |
| InChIKey | XUKMVIRZGHZIDS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide (CID 27352472) is N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide is Cc1ccc(SCC(=O)c2ccc(CCNS(C)(=O)=O)s2)c(C)c1.
What is the InChIKey of N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide?
The InChIKey is XUKMVIRZGHZIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3S3/c1-12-4-6-16(13(2)10-12)22-11-15(19)17-7-5-14(23-17)8-9-18-24(3,20)21/h4-7,10,18H,8-9,11H2,1-3H3.
What are the key properties of N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide?
N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide has a molecular weight of 383.56 g/mol, XLogP of 3.43, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[5-[2-(2,4-dimethylphenyl)sulfanylacetyl]thiophen-2-yl]ethyl]methanesulfonamide is sourced from PubChem (CID 27352472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).