About (4-acetylphenyl)thiourea
(4-acetylphenyl)thiourea (PubChem CID 2735266) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is (4-acetylphenyl)thiourea.
Molecular Properties
| Compound Name | (4-acetylphenyl)thiourea |
| PubChem CID | 2735266 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (4-acetylphenyl)thiourea |
| SMILES | CC(=O)c1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C9H10N2OS/c1-6(12)7-2-4-8(5-3-7)11-9(10)13/h2-5H,1H3,(H3,10,11,13) |
| InChIKey | VVIUKYOXYSWCOF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-acetylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl)thiourea?
The IUPAC name of (4-acetylphenyl)thiourea (CID 2735266) is (4-acetylphenyl)thiourea.
What is the SMILES notation for (4-acetylphenyl)thiourea?
The canonical SMILES for (4-acetylphenyl)thiourea is CC(=O)c1ccc(NC(N)=S)cc1.
What is the InChIKey of (4-acetylphenyl)thiourea?
The InChIKey is VVIUKYOXYSWCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-6(12)7-2-4-8(5-3-7)11-9(10)13/h2-5H,1H3,(H3,10,11,13).
What are the key properties of (4-acetylphenyl)thiourea?
(4-acetylphenyl)thiourea has a molecular weight of 194.26 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl)thiourea is sourced from PubChem (CID 2735266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).