About 2-amino-6-methoxybenzoic acid
2-amino-6-methoxybenzoic acid (PubChem CID 2735357) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-amino-6-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-amino-6-methoxybenzoic acid |
| PubChem CID | 2735357 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-amino-6-methoxybenzoic acid |
| SMILES | COc1cccc(N)c1C(=O)O |
| InChI | InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | DYZDIWNRWSNVPT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-methoxybenzoic acid?
The IUPAC name of 2-amino-6-methoxybenzoic acid (CID 2735357) is 2-amino-6-methoxybenzoic acid.
What is the SMILES notation for 2-amino-6-methoxybenzoic acid?
The canonical SMILES for 2-amino-6-methoxybenzoic acid is COc1cccc(N)c1C(=O)O.
What is the InChIKey of 2-amino-6-methoxybenzoic acid?
The InChIKey is DYZDIWNRWSNVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,9H2,1H3,(H,10,11).
What are the key properties of 2-amino-6-methoxybenzoic acid?
2-amino-6-methoxybenzoic acid has a molecular weight of 167.16 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-methoxybenzoic acid is sourced from PubChem (CID 2735357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).