2,1,3-benzoxadiazole-5-carbonyl chloride

C7H3ClN2O2 — CID 2735453

IUPAC2,1,3-benzoxadiazole-5-carbonyl chloride
SMILESO=C(Cl)c1ccc2nonc2c1
InChIInChI=1S/C7H3ClN2O2/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H
InChIKeyODCMBRSQNVPDOK-UHFFFAOYSA-N
MW182.57 g/mol
LogP1.60
Rot. Bonds1

About 2,1,3-benzoxadiazole-5-carbonyl chloride

2,1,3-benzoxadiazole-5-carbonyl chloride (PubChem CID 2735453) has the molecular formula C7H3ClN2O2 and a molecular weight of 182.57 g/mol. Its IUPAC name is 2,1,3-benzoxadiazole-5-carbonyl chloride.

Molecular Properties

Compound Name2,1,3-benzoxadiazole-5-carbonyl chloride
PubChem CID2735453
Molecular FormulaC7H3ClN2O2
Molecular Weight182.57 g/mol
Exact Mass181.99
IUPAC Name2,1,3-benzoxadiazole-5-carbonyl chloride
SMILESO=C(Cl)c1ccc2nonc2c1
InChIInChI=1S/C7H3ClN2O2/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H
InChIKeyODCMBRSQNVPDOK-UHFFFAOYSA-N
XLogP1.60
TPSA55.99 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.57
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,1,3-benzoxadiazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,1,3-benzoxadiazole-5-carbonyl chloride?
The IUPAC name of 2,1,3-benzoxadiazole-5-carbonyl chloride (CID 2735453) is 2,1,3-benzoxadiazole-5-carbonyl chloride.
What is the SMILES notation for 2,1,3-benzoxadiazole-5-carbonyl chloride?
The canonical SMILES for 2,1,3-benzoxadiazole-5-carbonyl chloride is O=C(Cl)c1ccc2nonc2c1.
What is the InChIKey of 2,1,3-benzoxadiazole-5-carbonyl chloride?
The InChIKey is ODCMBRSQNVPDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2O2/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H.
What are the key properties of 2,1,3-benzoxadiazole-5-carbonyl chloride?
2,1,3-benzoxadiazole-5-carbonyl chloride has a molecular weight of 182.57 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzoxadiazole-5-carbonyl chloride is sourced from PubChem (CID 2735453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).