C12Cl10S2Zn-2 — CID 2735526
bis(2,3,4,5,6-pentachlorobenzenethiolate);zinc (PubChem CID 2735526) has the molecular formula C12Cl10S2Zn-2 and a molecular weight of 628.19 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentachlorobenzenethiolate);zinc.
| Compound Name | bis(2,3,4,5,6-pentachlorobenzenethiolate);zinc |
|---|---|
| PubChem CID | 2735526 |
| Molecular Formula | C12Cl10S2Zn-2 |
| Molecular Weight | 628.19 g/mol |
| Exact Mass | 621.56 |
| IUPAC Name | bis(2,3,4,5,6-pentachlorobenzenethiolate);zinc |
| SMILES | [S-]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[S-]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[Zn] |
| InChI | InChI=1S/2C6HCl5S.Zn/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;/h2*12H;/p-2 |
| InChIKey | BVKIOLPYGZHYNY-UHFFFAOYSA-L |
| XLogP | 9.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.19 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|