About 3-bromo-2-methylbenzoic acid
3-bromo-2-methylbenzoic acid (PubChem CID 2735590) has the molecular formula C8H7BrO2
and a molecular weight of 215.05 g/mol. Its IUPAC name is 3-bromo-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-2-methylbenzoic acid |
| PubChem CID | 2735590 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 3-bromo-2-methylbenzoic acid |
| SMILES | Cc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C8H7BrO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | BJGKVCKGUBYULR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methylbenzoic acid?
The IUPAC name of 3-bromo-2-methylbenzoic acid (CID 2735590) is 3-bromo-2-methylbenzoic acid.
What is the SMILES notation for 3-bromo-2-methylbenzoic acid?
The canonical SMILES for 3-bromo-2-methylbenzoic acid is Cc1c(Br)cccc1C(=O)O.
What is the InChIKey of 3-bromo-2-methylbenzoic acid?
The InChIKey is BJGKVCKGUBYULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11).
What are the key properties of 3-bromo-2-methylbenzoic acid?
3-bromo-2-methylbenzoic acid has a molecular weight of 215.05 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methylbenzoic acid is sourced from PubChem (CID 2735590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).