2-[(1,1-dioxothiolan-3-yl)amino]acetic acid

C6H11NO4S — CID 2735704

IUPAC2-[(1,1-dioxothiolan-3-yl)amino]acetic acid
SMILESO=C(O)CNC1CCS(=O)(=O)C1
InChIInChI=1S/C6H11NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h5,7H,1-4H2,(H,8,9)
InChIKeyNLJKAAYXSDTMSI-UHFFFAOYSA-N
MW193.22 g/mol
LogP-1.15
Rot. Bonds3

About 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid

2-[(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 2735704) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-3-yl)amino]acetic acid
PubChem CID2735704
Molecular FormulaC6H11NO4S
Molecular Weight193.22 g/mol
Exact Mass193.04
IUPAC Name2-[(1,1-dioxothiolan-3-yl)amino]acetic acid
SMILESO=C(O)CNC1CCS(=O)(=O)C1
InChIInChI=1S/C6H11NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h5,7H,1-4H2,(H,8,9)
InChIKeyNLJKAAYXSDTMSI-UHFFFAOYSA-N
XLogP-1.15
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.22
LogP ≤ 5-1.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid (CID 2735704) is 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid is O=C(O)CNC1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid?
The InChIKey is NLJKAAYXSDTMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h5,7H,1-4H2,(H,8,9).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid?
2-[(1,1-dioxothiolan-3-yl)amino]acetic acid has a molecular weight of 193.22 g/mol, XLogP of -1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)amino]acetic acid is sourced from PubChem (CID 2735704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).