About 1-cyclooctylpiperazine
1-cyclooctylpiperazine (PubChem CID 2735889) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-cyclooctylpiperazine.
Molecular Properties
| Compound Name | 1-cyclooctylpiperazine |
| PubChem CID | 2735889 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-cyclooctylpiperazine |
| SMILES | C1CCCC(N2CCNCC2)CCC1 |
| InChI | InChI=1S/C12H24N2/c1-2-4-6-12(7-5-3-1)14-10-8-13-9-11-14/h12-13H,1-11H2 |
| InChIKey | PXPPUXBOQHHYEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclooctylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctylpiperazine?
The IUPAC name of 1-cyclooctylpiperazine (CID 2735889) is 1-cyclooctylpiperazine.
What is the SMILES notation for 1-cyclooctylpiperazine?
The canonical SMILES for 1-cyclooctylpiperazine is C1CCCC(N2CCNCC2)CCC1.
What is the InChIKey of 1-cyclooctylpiperazine?
The InChIKey is PXPPUXBOQHHYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-2-4-6-12(7-5-3-1)14-10-8-13-9-11-14/h12-13H,1-11H2.
What are the key properties of 1-cyclooctylpiperazine?
1-cyclooctylpiperazine has a molecular weight of 196.34 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctylpiperazine is sourced from PubChem (CID 2735889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).