About cyclopentyl carbonochloridate
cyclopentyl carbonochloridate (PubChem CID 2735892) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is cyclopentyl carbonochloridate.
Molecular Properties
| Compound Name | cyclopentyl carbonochloridate |
| PubChem CID | 2735892 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | cyclopentyl carbonochloridate |
| SMILES | O=C(Cl)OC1CCCC1 |
| InChI | InChI=1S/C6H9ClO2/c7-6(8)9-5-3-1-2-4-5/h5H,1-4H2 |
| InChIKey | ZFQCRLNKHHXELH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl carbonochloridate?
The IUPAC name of cyclopentyl carbonochloridate (CID 2735892) is cyclopentyl carbonochloridate.
What is the SMILES notation for cyclopentyl carbonochloridate?
The canonical SMILES for cyclopentyl carbonochloridate is O=C(Cl)OC1CCCC1.
What is the InChIKey of cyclopentyl carbonochloridate?
The InChIKey is ZFQCRLNKHHXELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2/c7-6(8)9-5-3-1-2-4-5/h5H,1-4H2.
What are the key properties of cyclopentyl carbonochloridate?
cyclopentyl carbonochloridate has a molecular weight of 148.59 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl carbonochloridate is sourced from PubChem (CID 2735892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).