C9H6F5NO2 — CID 2735935
2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (PubChem CID 2735935) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 2735935 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| SMILES | NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H6F5NO2/c10-4-2(1-3(15)9(16)17)5(11)7(13)8(14)6(4)12/h3H,1,15H2,(H,16,17) |
| InChIKey | YYTDJPUFAVPHQA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|