C9H6Cl2N2OS — CID 2735970
5-[(3,4-dichlorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2735970) has the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2735970 |
| Molecular Formula | C9H6Cl2N2OS |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(Cc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C9H6Cl2N2OS/c10-6-2-1-5(3-7(6)11)4-8-12-13-9(15)14-8/h1-3H,4H2,(H,13,15) |
| InChIKey | CBYCRFATPPEVBH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|