C12H10F6O3 — CID 2736073
1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]ethanone (PubChem CID 2736073) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]ethanone.
| Compound Name | 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 2736073 |
| Molecular Formula | C12H10F6O3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C12H10F6O3/c1-7(19)9-4-8(20-5-11(13,14)15)2-3-10(9)21-6-12(16,17)18/h2-4H,5-6H2,1H3 |
| InChIKey | CUKRFIGOPWVJGQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |