About bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate
bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate (PubChem CID 2736090) has the molecular formula C9H8F6O4
and a molecular weight of 294.15 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate |
| PubChem CID | 2736090 |
| Molecular Formula | C9H8F6O4 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H8F6O4/c1-5(7(17)19-4-9(13,14)15)2-6(16)18-3-8(10,11)12/h1-4H2 |
| InChIKey | IRXUFAGEXMCXHZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate?
The IUPAC name of bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate (CID 2736090) is bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate.
What is the SMILES notation for bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate?
The canonical SMILES for bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate is C=C(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F.
What is the InChIKey of bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate?
The InChIKey is IRXUFAGEXMCXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6O4/c1-5(7(17)19-4-9(13,14)15)2-6(16)18-3-8(10,11)12/h1-4H2.
What are the key properties of bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate?
bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate has a molecular weight of 294.15 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate is sourced from PubChem (CID 2736090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).