2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid

C7H5Cl2NO2S — CID 2736091

IUPAC2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid
SMILESO=C(O)CSc1cc(Cl)nc(Cl)c1
InChIInChI=1S/C7H5Cl2NO2S/c8-5-1-4(2-6(9)10-5)13-3-7(11)12/h1-2H,3H2,(H,11,12)
InChIKeyRMEPHJNBCRKTHN-UHFFFAOYSA-N
MW238.09 g/mol
LogP2.57
Rot. Bonds3

About 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid

2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid (PubChem CID 2736091) has the molecular formula C7H5Cl2NO2S and a molecular weight of 238.09 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid.

Molecular Properties

Compound Name2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid
PubChem CID2736091
Molecular FormulaC7H5Cl2NO2S
Molecular Weight238.09 g/mol
Exact Mass236.94
IUPAC Name2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid
SMILESO=C(O)CSc1cc(Cl)nc(Cl)c1
InChIInChI=1S/C7H5Cl2NO2S/c8-5-1-4(2-6(9)10-5)13-3-7(11)12/h1-2H,3H2,(H,11,12)
InChIKeyRMEPHJNBCRKTHN-UHFFFAOYSA-N
XLogP2.57
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.09
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid?
The IUPAC name of 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid (CID 2736091) is 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid is O=C(O)CSc1cc(Cl)nc(Cl)c1.
What is the InChIKey of 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid?
The InChIKey is RMEPHJNBCRKTHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO2S/c8-5-1-4(2-6(9)10-5)13-3-7(11)12/h1-2H,3H2,(H,11,12).
What are the key properties of 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid?
2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid has a molecular weight of 238.09 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetic acid is sourced from PubChem (CID 2736091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).