About 5-methylsulfonyl-2,3-dihydro-1H-indole
5-methylsulfonyl-2,3-dihydro-1H-indole (PubChem CID 2736136) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-methylsulfonyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2,3-dihydro-1H-indole |
| PubChem CID | 2736136 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 5-methylsulfonyl-2,3-dihydro-1H-indole |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C9H11NO2S/c1-13(11,12)8-2-3-9-7(6-8)4-5-10-9/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | OFYOHQMIBTVTKY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylsulfonyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-methylsulfonyl-2,3-dihydro-1H-indole (CID 2736136) is 5-methylsulfonyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-methylsulfonyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-methylsulfonyl-2,3-dihydro-1H-indole is CS(=O)(=O)c1ccc2c(c1)CCN2.
What is the InChIKey of 5-methylsulfonyl-2,3-dihydro-1H-indole?
The InChIKey is OFYOHQMIBTVTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-13(11,12)8-2-3-9-7(6-8)4-5-10-9/h2-3,6,10H,4-5H2,1H3.
What are the key properties of 5-methylsulfonyl-2,3-dihydro-1H-indole?
5-methylsulfonyl-2,3-dihydro-1H-indole has a molecular weight of 197.26 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 2736136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).