About phenacyl 2-morpholin-4-ylacetate
phenacyl 2-morpholin-4-ylacetate (PubChem CID 27362) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is phenacyl 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | phenacyl 2-morpholin-4-ylacetate |
| PubChem CID | 27362 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | phenacyl 2-morpholin-4-ylacetate |
| SMILES | O=C(CN1CCOCC1)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c16-13(12-4-2-1-3-5-12)11-19-14(17)10-15-6-8-18-9-7-15/h1-5H,6-11H2 |
| InChIKey | WIELTBTVQBNULW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenacyl 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 2-morpholin-4-ylacetate?
The IUPAC name of phenacyl 2-morpholin-4-ylacetate (CID 27362) is phenacyl 2-morpholin-4-ylacetate.
What is the SMILES notation for phenacyl 2-morpholin-4-ylacetate?
The canonical SMILES for phenacyl 2-morpholin-4-ylacetate is O=C(CN1CCOCC1)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl 2-morpholin-4-ylacetate?
The InChIKey is WIELTBTVQBNULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c16-13(12-4-2-1-3-5-12)11-19-14(17)10-15-6-8-18-9-7-15/h1-5H,6-11H2.
What are the key properties of phenacyl 2-morpholin-4-ylacetate?
phenacyl 2-morpholin-4-ylacetate has a molecular weight of 263.29 g/mol, XLogP of 0.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-morpholin-4-ylacetate is sourced from PubChem (CID 27362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).