About 4-isocyanato-3,5-dimethyl-1,2-oxazole
4-isocyanato-3,5-dimethyl-1,2-oxazole (PubChem CID 2736266) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 4-isocyanato-3,5-dimethyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-isocyanato-3,5-dimethyl-1,2-oxazole |
| PubChem CID | 2736266 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 4-isocyanato-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1N=C=O |
| InChI | InChI=1S/C6H6N2O2/c1-4-6(7-3-9)5(2)10-8-4/h1-2H3 |
| InChIKey | JJQYAGYVYNMYGE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanato-3,5-dimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanato-3,5-dimethyl-1,2-oxazole?
The IUPAC name of 4-isocyanato-3,5-dimethyl-1,2-oxazole (CID 2736266) is 4-isocyanato-3,5-dimethyl-1,2-oxazole.
What is the SMILES notation for 4-isocyanato-3,5-dimethyl-1,2-oxazole?
The canonical SMILES for 4-isocyanato-3,5-dimethyl-1,2-oxazole is Cc1noc(C)c1N=C=O.
What is the InChIKey of 4-isocyanato-3,5-dimethyl-1,2-oxazole?
The InChIKey is JJQYAGYVYNMYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-4-6(7-3-9)5(2)10-8-4/h1-2H3.
What are the key properties of 4-isocyanato-3,5-dimethyl-1,2-oxazole?
4-isocyanato-3,5-dimethyl-1,2-oxazole has a molecular weight of 138.13 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanato-3,5-dimethyl-1,2-oxazole is sourced from PubChem (CID 2736266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).