5-bromo-2-fluorobenzoic acid

C7H4BrFO2 — CID 2736315

IUPAC5-bromo-2-fluorobenzoic acid
SMILESO=C(O)c1cc(Br)ccc1F
InChIInChI=1S/C7H4BrFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)
InChIKeyPEXAZYDITWXYNJ-UHFFFAOYSA-N
MW219.01 g/mol
LogP2.29
Rot. Bonds1

About 5-bromo-2-fluorobenzoic acid

5-bromo-2-fluorobenzoic acid (PubChem CID 2736315) has the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. Its IUPAC name is 5-bromo-2-fluorobenzoic acid.

Molecular Properties

Compound Name5-bromo-2-fluorobenzoic acid
PubChem CID2736315
Molecular FormulaC7H4BrFO2
Molecular Weight219.01 g/mol
Exact Mass217.94
IUPAC Name5-bromo-2-fluorobenzoic acid
SMILESO=C(O)c1cc(Br)ccc1F
InChIInChI=1S/C7H4BrFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)
InChIKeyPEXAZYDITWXYNJ-UHFFFAOYSA-N
XLogP2.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.01
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-bromo-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-fluorobenzoic acid?
The IUPAC name of 5-bromo-2-fluorobenzoic acid (CID 2736315) is 5-bromo-2-fluorobenzoic acid.
What is the SMILES notation for 5-bromo-2-fluorobenzoic acid?
The canonical SMILES for 5-bromo-2-fluorobenzoic acid is O=C(O)c1cc(Br)ccc1F.
What is the InChIKey of 5-bromo-2-fluorobenzoic acid?
The InChIKey is PEXAZYDITWXYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11).
What are the key properties of 5-bromo-2-fluorobenzoic acid?
5-bromo-2-fluorobenzoic acid has a molecular weight of 219.01 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluorobenzoic acid is sourced from PubChem (CID 2736315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).