About 3-ethoxybenzenethiol
3-ethoxybenzenethiol (PubChem CID 2736350) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 3-ethoxybenzenethiol.
Molecular Properties
| Compound Name | 3-ethoxybenzenethiol |
| PubChem CID | 2736350 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 3-ethoxybenzenethiol |
| SMILES | CCOc1cccc(S)c1 |
| InChI | InChI=1S/C8H10OS/c1-2-9-7-4-3-5-8(10)6-7/h3-6,10H,2H2,1H3 |
| InChIKey | RTJMJGJLVSKSEB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxybenzenethiol?
The IUPAC name of 3-ethoxybenzenethiol (CID 2736350) is 3-ethoxybenzenethiol.
What is the SMILES notation for 3-ethoxybenzenethiol?
The canonical SMILES for 3-ethoxybenzenethiol is CCOc1cccc(S)c1.
What is the InChIKey of 3-ethoxybenzenethiol?
The InChIKey is RTJMJGJLVSKSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-2-9-7-4-3-5-8(10)6-7/h3-6,10H,2H2,1H3.
What are the key properties of 3-ethoxybenzenethiol?
3-ethoxybenzenethiol has a molecular weight of 154.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxybenzenethiol is sourced from PubChem (CID 2736350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).