C7H8N2O5 — CID 2736482
ethyl 2-(2,4,5-trioxoimidazolidin-1-yl)acetate (PubChem CID 2736482) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is ethyl 2-(2,4,5-trioxoimidazolidin-1-yl)acetate.
| Compound Name | ethyl 2-(2,4,5-trioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 2736482 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | ethyl 2-(2,4,5-trioxoimidazolidin-1-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C7H8N2O5/c1-2-14-4(10)3-9-6(12)5(11)8-7(9)13/h2-3H2,1H3,(H,8,11,13) |
| InChIKey | AGEBXKKZQBCBAA-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|