C18H18N2OS — CID 27364914
3-(1H-indol-3-yl)-N-(4-methylsulfanylphenyl)propanamide (PubChem CID 27364914) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-(4-methylsulfanylphenyl)propanamide.
| Compound Name | 3-(1H-indol-3-yl)-N-(4-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 27364914 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-(4-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccc(NC(=O)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-22-15-9-7-14(8-10-15)20-18(21)11-6-13-12-19-17-5-3-2-4-16(13)17/h2-5,7-10,12,19H,6,11H2,1H3,(H,20,21) |
| InChIKey | JEEAHNFFVKZRKF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |