About 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene
1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene (PubChem CID 2736496) has the molecular formula C7H2ClF5
and a molecular weight of 216.54 g/mol. Its IUPAC name is 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene |
| PubChem CID | 2736496 |
| Molecular Formula | C7H2ClF5 |
| Molecular Weight | 216.54 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene |
| SMILES | Fc1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C7H2ClF5/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H |
| InChIKey | RZMVFJHGONCXQR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene?
The IUPAC name of 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene (CID 2736496) is 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene.
What is the SMILES notation for 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene?
The canonical SMILES for 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene is Fc1cc(C(F)(F)F)cc(Cl)c1F.
What is the InChIKey of 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene?
The InChIKey is RZMVFJHGONCXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF5/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H.
What are the key properties of 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene?
1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene has a molecular weight of 216.54 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-difluoro-5-(trifluoromethyl)benzene is sourced from PubChem (CID 2736496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).