About triethylphosphane
triethylphosphane (PubChem CID 27365) has the molecular formula C6H15P
and a molecular weight of 118.16 g/mol. Its IUPAC name is triethylphosphane.
Molecular Properties
| Compound Name | triethylphosphane |
| PubChem CID | 27365 |
| Molecular Formula | C6H15P |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | triethylphosphane |
| SMILES | CCP(CC)CC |
| InChI | InChI=1S/C6H15P/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| InChIKey | RXJKFRMDXUJTEX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylphosphane?
The IUPAC name of triethylphosphane (CID 27365) is triethylphosphane.
What is the SMILES notation for triethylphosphane?
The canonical SMILES for triethylphosphane is CCP(CC)CC.
What is the InChIKey of triethylphosphane?
The InChIKey is RXJKFRMDXUJTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P/c1-4-7(5-2)6-3/h4-6H2,1-3H3.
What are the key properties of triethylphosphane?
triethylphosphane has a molecular weight of 118.16 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylphosphane is sourced from PubChem (CID 27365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).